In the crystal of the title compound, C(10)H(14)N(2)O, double supra-molecular layers of PhCH(2)CH(2)CH(2)NHC(O)NH(2) are formed parallel to the bc plane by inter-molecular N-H⋯O hydrogen bonding, with R(2) (2)(8) and R(2) (1)(6) motifs in the b- and c-axis directions, respectively. The mean plane of the C(ar)-C-C group makes a dihedral angle of 84.8 (2)° with the benzene ring.