Molecules of the title compound, C(28)H(27)ClN(4)O(4).C(2)H(6)O, form a C(6) chain via an N--H...O hydrogen bond along the c axis by the operation of a c-glide plane, with N...O = 2.761 (3) A and N--H...O = 165 degrees. The molecules are further linked by a weak C--H...O interaction, with C.O = 3.344 (4) A and C--H...O = 150 degrees. Pendant hydrogen-bonded ethanol solvent molecules are attached to the chains by O--H...N hydrogen bonds, with O...N = 2.904 (3) A and O--H...N = 175 degrees.